C24H23Cl2N7O — CID 58289856
4-amino-3-(2,6-dichlorophenyl)-7-[[8-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 58289856) has the molecular formula C24H23Cl2N7O and a molecular weight of 496.40 g/mol. Its IUPAC name is 4-amino-3-(2,6-dichlorophenyl)-7-[[8-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 4-amino-3-(2,6-dichlorophenyl)-7-[[8-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 58289856 |
| Molecular Formula | C24H23Cl2N7O |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 4-amino-3-(2,6-dichlorophenyl)-7-[[8-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | CN(C)C1CCCc2ccc(Nc3ncc4c(N)n(-c5c(Cl)cccc5Cl)c(=O)nc4n3)cc21 |
| InChI | InChI=1S/C24H23Cl2N7O/c1-32(2)19-8-3-5-13-9-10-14(11-15(13)19)29-23-28-12-16-21(27)33(24(34)31-22(16)30-23)20-17(25)6-4-7-18(20)26/h4,6-7,9-12,19H,3,5,8,27H2,1-2H3,(H,29,30,31,34) |
| InChIKey | SMALWAXWKRCVJO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |