C27H31Cl2N7O2 — CID 58455513
4-amino-7-[4-[1-butoxy-3-(dimethylamino)propyl]anilino]-3-(2,6-dichlorophenyl)pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 58455513) has the molecular formula C27H31Cl2N7O2 and a molecular weight of 556.50 g/mol. Its IUPAC name is 4-amino-7-[4-[1-butoxy-3-(dimethylamino)propyl]anilino]-3-(2,6-dichlorophenyl)pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 4-amino-7-[4-[1-butoxy-3-(dimethylamino)propyl]anilino]-3-(2,6-dichlorophenyl)pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 58455513 |
| Molecular Formula | C27H31Cl2N7O2 |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 4-amino-7-[4-[1-butoxy-3-(dimethylamino)propyl]anilino]-3-(2,6-dichlorophenyl)pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | CCCCOC(CCN(C)C)c1ccc(Nc2ncc3c(N)n(-c4c(Cl)cccc4Cl)c(=O)nc3n2)cc1 |
| InChI | InChI=1S/C27H31Cl2N7O2/c1-4-5-15-38-22(13-14-35(2)3)17-9-11-18(12-10-17)32-26-31-16-19-24(30)36(27(37)34-25(19)33-26)23-20(28)7-6-8-21(23)29/h6-12,16,22H,4-5,13-15,30H2,1-3H3,(H,32,33,34,37) |
| InChIKey | IWPQQGOGVMWHIQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|