C24H23Cl2N9O — CID 58455517
4-amino-3-(2,6-dichlorophenyl)-7-[4-(4-ethanimidoylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 58455517) has the molecular formula C24H23Cl2N9O and a molecular weight of 524.42 g/mol. Its IUPAC name is 4-amino-3-(2,6-dichlorophenyl)-7-[4-(4-ethanimidoylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 4-amino-3-(2,6-dichlorophenyl)-7-[4-(4-ethanimidoylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 58455517 |
| Molecular Formula | C24H23Cl2N9O |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 4-amino-3-(2,6-dichlorophenyl)-7-[4-(4-ethanimidoylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | [H]/N=C(\C)N1CCN(c2ccc(Nc3ncc4c(N)n(-c5c(Cl)cccc5Cl)c(=O)nc4n3)cc2)CC1 |
| InChI | InChI=1S/C24H23Cl2N9O/c1-14(27)33-9-11-34(12-10-33)16-7-5-15(6-8-16)30-23-29-13-17-21(28)35(24(36)32-22(17)31-23)20-18(25)3-2-4-19(20)26/h2-8,13,27H,9-12,28H2,1H3,(H,30,31,32,36)/b27-14+ |
| InChIKey | ISYJXQPLKFPGSY-MZJWZYIUSA-N |
| XLogP | 3.93 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|