C21H16Cl3N5OS — CID 138531598
7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-3-(2,4,6-trichlorophenyl)-2H-pyrimido[5,4-e][1,3]thiazin-4-one (PubChem CID 138531598) has the molecular formula C21H16Cl3N5OS and a molecular weight of 492.82 g/mol. Its IUPAC name is 7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-3-(2,4,6-trichlorophenyl)-2H-pyrimido[5,4-e][1,3]thiazin-4-one.
| Compound Name | 7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-3-(2,4,6-trichlorophenyl)-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 138531598 |
| Molecular Formula | C21H16Cl3N5OS |
| Molecular Weight | 492.82 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | 7-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-3-(2,4,6-trichlorophenyl)-2H-pyrimido[5,4-e][1,3]thiazin-4-one |
| SMILES | O=C1c2cnc(Nc3ccc4c(c3)CNCC4)nc2SCN1c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl3N5OS/c22-13-6-16(23)18(17(24)7-13)29-10-31-19-15(20(29)30)9-26-21(28-19)27-14-2-1-11-3-4-25-8-12(11)5-14/h1-2,5-7,9,25H,3-4,8,10H2,(H,26,27,28) |
| InChIKey | OQULCJTWHOTHGM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.82 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |