C29H30Cl2N6O3S — CID 138531034
N-[2-[6-[[3-(2,6-dichlorophenyl)-4-oxo-2H-pyrimido[5,4-e][1,3]thiazin-7-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3-hydroxycyclopentane-1-carboxamide (PubChem CID 138531034) has the molecular formula C29H30Cl2N6O3S and a molecular weight of 613.57 g/mol. Its IUPAC name is N-[2-[6-[[3-(2,6-dichlorophenyl)-4-oxo-2H-pyrimido[5,4-e][1,3]thiazin-7-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3-hydroxycyclopentane-1-carboxamide.
| Compound Name | N-[2-[6-[[3-(2,6-dichlorophenyl)-4-oxo-2H-pyrimido[5,4-e][1,3]thiazin-7-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 138531034 |
| Molecular Formula | C29H30Cl2N6O3S |
| Molecular Weight | 613.57 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | N-[2-[6-[[3-(2,6-dichlorophenyl)-4-oxo-2H-pyrimido[5,4-e][1,3]thiazin-7-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3-hydroxycyclopentane-1-carboxamide |
| SMILES | O=C(NCCN1CCc2cc(Nc3ncc4c(n3)SCN(c3c(Cl)cccc3Cl)C4=O)ccc2C1)C1CCC(O)C1 |
| InChI | InChI=1S/C29H30Cl2N6O3S/c30-23-2-1-3-24(31)25(23)37-16-41-27-22(28(37)40)14-33-29(35-27)34-20-6-4-19-15-36(10-8-17(19)12-20)11-9-32-26(39)18-5-7-21(38)13-18/h1-4,6,12,14,18,21,38H,5,7-11,13,15-16H2,(H,32,39)(H,33,34,35) |
| InChIKey | ODUWSDWOJSZGIL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |