C25H26Cl2N6O2 — CID 138521598
3-(2,6-dichlorophenyl)-7-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138521598) has the molecular formula C25H26Cl2N6O2 and a molecular weight of 513.43 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138521598 |
| Molecular Formula | C25H26Cl2N6O2 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | CN(C)C1CCN(c2ccc(Nc3ncc4c(n3)OCN(c3c(Cl)cccc3Cl)C4=O)cc2)CC1 |
| InChI | InChI=1S/C25H26Cl2N6O2/c1-31(2)17-10-12-32(13-11-17)18-8-6-16(7-9-18)29-25-28-14-19-23(30-25)35-15-33(24(19)34)22-20(26)4-3-5-21(22)27/h3-9,14,17H,10-13,15H2,1-2H3,(H,28,29,30) |
| InChIKey | BNSPONUTPALMRW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|