C29H29Cl2N7O2 — CID 138531048
3-(2,6-dichlorophenyl)-7-[4-[4-(dimethylamino)piperidin-1-yl]-3-pyrrol-1-ylanilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138531048) has the molecular formula C29H29Cl2N7O2 and a molecular weight of 578.50 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[4-[4-(dimethylamino)piperidin-1-yl]-3-pyrrol-1-ylanilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[4-[4-(dimethylamino)piperidin-1-yl]-3-pyrrol-1-ylanilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138531048 |
| Molecular Formula | C29H29Cl2N7O2 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[4-[4-(dimethylamino)piperidin-1-yl]-3-pyrrol-1-ylanilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | CN(C)C1CCN(c2ccc(Nc3ncc4c(n3)OCN(c3c(Cl)cccc3Cl)C4=O)cc2-n2cccc2)CC1 |
| InChI | InChI=1S/C29H29Cl2N7O2/c1-35(2)20-10-14-37(15-11-20)24-9-8-19(16-25(24)36-12-3-4-13-36)33-29-32-17-21-27(34-29)40-18-38(28(21)39)26-22(30)6-5-7-23(26)31/h3-9,12-13,16-17,20H,10-11,14-15,18H2,1-2H3,(H,32,33,34) |
| InChIKey | FTBKUKFRBNHJGZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|