C25H27Cl2N7O — CID 118189136
6-(2,6-dichlorophenyl)-2-[4-(3,3-dimethylpiperazin-1-yl)anilino]-8-methyl-7H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 118189136) has the molecular formula C25H27Cl2N7O and a molecular weight of 512.45 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[4-(3,3-dimethylpiperazin-1-yl)anilino]-8-methyl-7H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[4-(3,3-dimethylpiperazin-1-yl)anilino]-8-methyl-7H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 118189136 |
| Molecular Formula | C25H27Cl2N7O |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-(3,3-dimethylpiperazin-1-yl)anilino]-8-methyl-7H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | CN1CN(c2c(Cl)cccc2Cl)C(=O)c2cnc(Nc3ccc(N4CCNC(C)(C)C4)cc3)nc21 |
| InChI | InChI=1S/C25H27Cl2N7O/c1-25(2)14-33(12-11-29-25)17-9-7-16(8-10-17)30-24-28-13-18-22(31-24)32(3)15-34(23(18)35)21-19(26)5-4-6-20(21)27/h4-10,13,29H,11-12,14-15H2,1-3H3,(H,28,30,31) |
| InChIKey | KMQLDJJMLMAAJT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|