C22H22Cl2N6O2 — CID 118189116
6-(2,6-dichlorophenyl)-8-methyl-2-[4-[2-(methylamino)ethoxy]anilino]-7H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 118189116) has the molecular formula C22H22Cl2N6O2 and a molecular weight of 473.36 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-methyl-2-[4-[2-(methylamino)ethoxy]anilino]-7H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[4-[2-(methylamino)ethoxy]anilino]-7H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 118189116 |
| Molecular Formula | C22H22Cl2N6O2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[4-[2-(methylamino)ethoxy]anilino]-7H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | CNCCOc1ccc(Nc2ncc3c(n2)N(C)CN(c2c(Cl)cccc2Cl)C3=O)cc1 |
| InChI | InChI=1S/C22H22Cl2N6O2/c1-25-10-11-32-15-8-6-14(7-9-15)27-22-26-12-16-20(28-22)29(2)13-30(21(16)31)19-17(23)4-3-5-18(19)24/h3-9,12,25H,10-11,13H2,1-2H3,(H,26,27,28) |
| InChIKey | GBTFLFHQAMXZJU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|