C27H28Cl2F3N7O3 — CID 118189083
6-(2,6-dichlorophenyl)-2-[4-[(3R)-3-(methoxymethyl)piperazin-1-yl]-3-(2,2,2-trifluoro-1-hydroxyethyl)anilino]-8-methyl-7H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 118189083) has the molecular formula C27H28Cl2F3N7O3 and a molecular weight of 626.47 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[4-[(3R)-3-(methoxymethyl)piperazin-1-yl]-3-(2,2,2-trifluoro-1-hydroxyethyl)anilino]-8-methyl-7H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[4-[(3R)-3-(methoxymethyl)piperazin-1-yl]-3-(2,2,2-trifluoro-1-hydroxyethyl)anilino]-8-methyl-7H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 118189083 |
| Molecular Formula | C27H28Cl2F3N7O3 |
| Molecular Weight | 626.47 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-[(3R)-3-(methoxymethyl)piperazin-1-yl]-3-(2,2,2-trifluoro-1-hydroxyethyl)anilino]-8-methyl-7H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | COC[C@H]1CN(c2ccc(Nc3ncc4c(n3)N(C)CN(c3c(Cl)cccc3Cl)C4=O)cc2C(O)C(F)(F)F)CCN1 |
| InChI | InChI=1S/C27H28Cl2F3N7O3/c1-37-14-39(22-19(28)4-3-5-20(22)29)25(41)18-11-34-26(36-24(18)37)35-15-6-7-21(17(10-15)23(40)27(30,31)32)38-9-8-33-16(12-38)13-42-2/h3-7,10-11,16,23,33,40H,8-9,12-14H2,1-2H3,(H,34,35,36)/t16-,23?/m1/s1 |
| InChIKey | JGJVAYGKXJZQPK-ADRQNKRLSA-N |
| XLogP | 4.60 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|