C19H22N6O2 — CID 138531055
3-cyclopropyl-7-(4-piperazin-1-ylanilino)-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138531055) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 3-cyclopropyl-7-(4-piperazin-1-ylanilino)-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 3-cyclopropyl-7-(4-piperazin-1-ylanilino)-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138531055 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-cyclopropyl-7-(4-piperazin-1-ylanilino)-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | O=C1c2cnc(Nc3ccc(N4CCNCC4)cc3)nc2OCN1C1CC1 |
| InChI | InChI=1S/C19H22N6O2/c26-18-16-11-21-19(23-17(16)27-12-25(18)15-5-6-15)22-13-1-3-14(4-2-13)24-9-7-20-8-10-24/h1-4,11,15,20H,5-10,12H2,(H,21,22,23) |
| InChIKey | HMPSRQKNKCLTOY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|