C27H32N6O — CID 151718666
8-(2-adamantyl)-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 151718666) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is 8-(2-adamantyl)-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(2-adamantyl)-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 151718666 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 8-(2-adamantyl)-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(Nc3ccc(N4CCNCC4)cc3)nc2n1C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C27H32N6O/c34-24-6-1-19-16-29-27(30-22-2-4-23(5-3-22)32-9-7-28-8-10-32)31-26(19)33(24)25-20-12-17-11-18(14-20)15-21(25)13-17/h1-6,16-18,20-21,25,28H,7-15H2,(H,29,30,31) |
| InChIKey | RICJGDWORWOAQL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|