C29H37N5O2 — CID 167346530
8-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-[4-[4-(3-hydroxybutyl)piperidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 167346530) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 8-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-[4-[4-(3-hydroxybutyl)piperidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-[4-[4-(3-hydroxybutyl)piperidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 167346530 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 8-[(2R)-2-bicyclo[2.2.1]heptanyl]-2-[4-[4-(3-hydroxybutyl)piperidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC(O)CCC1CCN(c2ccc(Nc3ncc4ccc(=O)n([C@@H]5CC6CCC5C6)c4n3)cc2)CC1 |
| InChI | InChI=1S/C29H37N5O2/c1-19(35)2-3-20-12-14-33(15-13-20)25-9-7-24(8-10-25)31-29-30-18-23-6-11-27(36)34(28(23)32-29)26-17-21-4-5-22(26)16-21/h6-11,18-22,26,35H,2-5,12-17H2,1H3,(H,30,31,32)/t19?,21?,22?,26-/m1/s1 |
| InChIKey | LFEIANDMICYXHY-JNLMOAAUSA-N |
| XLogP | 5.27 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|