C29H35N7O — CID 156748077
8-[2-(1-buta-1,3-dien-2-ylazetidin-3-yl)ethyl]-2-[4-(4-cyclopropylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 156748077) has the molecular formula C29H35N7O and a molecular weight of 497.65 g/mol. Its IUPAC name is 8-[2-(1-buta-1,3-dien-2-ylazetidin-3-yl)ethyl]-2-[4-(4-cyclopropylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[2-(1-buta-1,3-dien-2-ylazetidin-3-yl)ethyl]-2-[4-(4-cyclopropylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 156748077 |
| Molecular Formula | C29H35N7O |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 8-[2-(1-buta-1,3-dien-2-ylazetidin-3-yl)ethyl]-2-[4-(4-cyclopropylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CC(=C)N1CC(CCn2c(=O)ccc3cnc(Nc4ccc(N5CCN(C6CC6)CC5)cc4)nc32)C1 |
| InChI | InChI=1S/C29H35N7O/c1-3-21(2)35-19-22(20-35)12-13-36-27(37)11-4-23-18-30-29(32-28(23)36)31-24-5-7-25(8-6-24)33-14-16-34(17-15-33)26-9-10-26/h3-8,11,18,22,26H,1-2,9-10,12-17,19-20H2,(H,30,31,32) |
| InChIKey | JZAAQIRPZJUZDM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|