C26H30N6O2 — CID 156511050
2-(3-piperidin-1-ylanilino)-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 156511050) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 2-(3-piperidin-1-ylanilino)-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(3-piperidin-1-ylanilino)-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 156511050 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 2-(3-piperidin-1-ylanilino)-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CC(=O)N1CC(CCn2c(=O)ccc3cnc(Nc4cccc(N5CCCCC5)c4)nc32)C1 |
| InChI | InChI=1S/C26H30N6O2/c1-2-23(33)31-17-19(18-31)11-14-32-24(34)10-9-20-16-27-26(29-25(20)32)28-21-7-6-8-22(15-21)30-12-4-3-5-13-30/h2,6-10,15-16,19H,1,3-5,11-14,17-18H2,(H,27,28,29) |
| InChIKey | YFXLHWQBGPKUBW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|