C29H30N6O2 — CID 156511187
2-[4-[benzyl(methyl)amino]anilino]-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 156511187) has the molecular formula C29H30N6O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 2-[4-[benzyl(methyl)amino]anilino]-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-[benzyl(methyl)amino]anilino]-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 156511187 |
| Molecular Formula | C29H30N6O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 2-[4-[benzyl(methyl)amino]anilino]-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CC(=O)N1CC(CCn2c(=O)ccc3cnc(Nc4ccc(N(C)Cc5ccccc5)cc4)nc32)C1 |
| InChI | InChI=1S/C29H30N6O2/c1-3-26(36)34-19-22(20-34)15-16-35-27(37)14-9-23-17-30-29(32-28(23)35)31-24-10-12-25(13-11-24)33(2)18-21-7-5-4-6-8-21/h3-14,17,22H,1,15-16,18-20H2,2H3,(H,30,31,32) |
| InChIKey | HRWFXTOQFLSGQY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|