C16H18N4O2 — CID 156748028
2-methyl-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 156748028) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-methyl-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-methyl-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 156748028 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-methyl-8-[2-(1-prop-2-enoylazetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CC(=O)N1CC(CCn2c(=O)ccc3cnc(C)nc32)C1 |
| InChI | InChI=1S/C16H18N4O2/c1-3-14(21)19-9-12(10-19)6-7-20-15(22)5-4-13-8-17-11(2)18-16(13)20/h3-5,8,12H,1,6-7,9-10H2,2H3 |
| InChIKey | BWLHMESFDTWBEW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|