C23H29N5O — CID 10135072
8-cyclopentyl-2-(4-piperazin-1-ylanilino)-6,8-dihydro-5H-quinazolin-7-one (PubChem CID 10135072) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is 8-cyclopentyl-2-(4-piperazin-1-ylanilino)-6,8-dihydro-5H-quinazolin-7-one.
| Compound Name | 8-cyclopentyl-2-(4-piperazin-1-ylanilino)-6,8-dihydro-5H-quinazolin-7-one |
|---|---|
| PubChem CID | 10135072 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 8-cyclopentyl-2-(4-piperazin-1-ylanilino)-6,8-dihydro-5H-quinazolin-7-one |
| SMILES | O=C1CCc2cnc(Nc3ccc(N4CCNCC4)cc3)nc2C1C1CCCC1 |
| InChI | InChI=1S/C23H29N5O/c29-20-10-5-17-15-25-23(27-22(17)21(20)16-3-1-2-4-16)26-18-6-8-19(9-7-18)28-13-11-24-12-14-28/h6-9,15-16,21,24H,1-5,10-14H2,(H,25,26,27) |
| InChIKey | XZMGUJIUDBLTCU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|