C20H26N6O2S — CID 10237895
3-methyl-2,2-dioxo-N-(4-piperazin-1-ylphenyl)-1-propan-2-ylpyrimido[4,5-c]thiazin-7-amine (PubChem CID 10237895) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is 3-methyl-2,2-dioxo-N-(4-piperazin-1-ylphenyl)-1-propan-2-ylpyrimido[4,5-c]thiazin-7-amine.
| Compound Name | 3-methyl-2,2-dioxo-N-(4-piperazin-1-ylphenyl)-1-propan-2-ylpyrimido[4,5-c]thiazin-7-amine |
|---|---|
| PubChem CID | 10237895 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 3-methyl-2,2-dioxo-N-(4-piperazin-1-ylphenyl)-1-propan-2-ylpyrimido[4,5-c]thiazin-7-amine |
| SMILES | CC1=Cc2cnc(Nc3ccc(N4CCNCC4)cc3)nc2N(C(C)C)S1(=O)=O |
| InChI | InChI=1S/C20H26N6O2S/c1-14(2)26-19-16(12-15(3)29(26,27)28)13-22-20(24-19)23-17-4-6-18(7-5-17)25-10-8-21-9-11-25/h4-7,12-14,21H,8-11H2,1-3H3,(H,22,23,24) |
| InChIKey | AQHYEXSTLAHTPZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|