C22H21ClFN3O2 — CID 7922491
3-(2-chloro-6-fluorophenyl)-5-methyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-carboxamide (PubChem CID 7922491) has the molecular formula C22H21ClFN3O2 and a molecular weight of 413.88 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-5-methyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-5-methyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 7922491 |
| Molecular Formula | C22H21ClFN3O2 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-5-methyl-N-(4-piperidin-1-ylphenyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H21ClFN3O2/c1-14-19(21(26-29-14)20-17(23)6-5-7-18(20)24)22(28)25-15-8-10-16(11-9-15)27-12-3-2-4-13-27/h5-11H,2-4,12-13H2,1H3,(H,25,28) |
| InChIKey | WDRXGJVEGNJNRD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|