C21H17ClF3N3O2 — CID 52666564
3-(2-chloro-6-fluorophenyl)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 52666564) has the molecular formula C21H17ClF3N3O2 and a molecular weight of 435.83 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 52666564 |
| Molecular Formula | C21H17ClF3N3O2 |
| Molecular Weight | 435.83 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)Nc1cc(F)c(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C21H17ClF3N3O2/c1-11-17(19(27-30-11)18-13(22)5-4-6-14(18)23)21(29)26-12-9-15(24)20(16(25)10-12)28-7-2-3-8-28/h4-6,9-10H,2-3,7-8H2,1H3,(H,26,29) |
| InChIKey | FHTXLHRVJHVVOU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.83 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|