C16H19BClN5O — CID 87092140
5-chloro-3-[4-(4-methyl-1,4-azaborinan-1-yl)anilino]pyrazine-2-carboxamide (PubChem CID 87092140) has the molecular formula C16H19BClN5O and a molecular weight of 343.63 g/mol. Its IUPAC name is 5-chloro-3-[4-(4-methyl-1,4-azaborinan-1-yl)anilino]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-3-[4-(4-methyl-1,4-azaborinan-1-yl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 87092140 |
| Molecular Formula | C16H19BClN5O |
| Molecular Weight | 343.63 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 5-chloro-3-[4-(4-methyl-1,4-azaborinan-1-yl)anilino]pyrazine-2-carboxamide |
| SMILES | CB1CCN(c2ccc(Nc3nc(Cl)cnc3C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C16H19BClN5O/c1-17-6-8-23(9-7-17)12-4-2-11(3-5-12)21-16-14(15(19)24)20-10-13(18)22-16/h2-5,10H,6-9H2,1H3,(H2,19,24)(H,21,22) |
| InChIKey | XXKUWWRVAVVMBI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.63 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|