C23H23N7O — CID 175321041
5-(3-cyanophenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide (PubChem CID 175321041) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is 5-(3-cyanophenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide.
| Compound Name | 5-(3-cyanophenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 175321041 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 5-(3-cyanophenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide |
| SMILES | CN1CCN(c2ccc(Nc3nc(-c4cccc(C#N)c4)cnc3C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C23H23N7O/c1-29-9-11-30(12-10-29)19-7-5-18(6-8-19)27-23-21(22(25)31)26-15-20(28-23)17-4-2-3-16(13-17)14-24/h2-8,13,15H,9-12H2,1H3,(H2,25,31)(H,27,28) |
| InChIKey | YEVCHJLOCWCHRQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|