C32H42N8O2 — CID 118115154
5-[3-[(4-tert-butylbenzoyl)amino]piperidin-1-yl]-3-[4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide (PubChem CID 118115154) has the molecular formula C32H42N8O2 and a molecular weight of 570.74 g/mol. Its IUPAC name is 5-[3-[(4-tert-butylbenzoyl)amino]piperidin-1-yl]-3-[4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide.
| Compound Name | 5-[3-[(4-tert-butylbenzoyl)amino]piperidin-1-yl]-3-[4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118115154 |
| Molecular Formula | C32H42N8O2 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | 5-[3-[(4-tert-butylbenzoyl)amino]piperidin-1-yl]-3-[4-(4-methylpiperazin-1-yl)anilino]pyrazine-2-carboxamide |
| SMILES | CN1CCN(c2ccc(Nc3nc(N4CCCC(NC(=O)c5ccc(C(C)(C)C)cc5)C4)cnc3C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C32H42N8O2/c1-32(2,3)23-9-7-22(8-10-23)31(42)36-25-6-5-15-40(21-25)27-20-34-28(29(33)41)30(37-27)35-24-11-13-26(14-12-24)39-18-16-38(4)17-19-39/h7-14,20,25H,5-6,15-19,21H2,1-4H3,(H2,33,41)(H,35,37)(H,36,42) |
| InChIKey | ITGUQNXUVZYULD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|