C28H35N7O5 — CID 118115194
2-[4-[[3-carbamoyl-6-[3-[(4-methoxybenzoyl)amino]piperidin-1-yl]pyrazin-2-yl]amino]phenoxy]-N,N-dimethylethanamine oxide (PubChem CID 118115194) has the molecular formula C28H35N7O5 and a molecular weight of 549.63 g/mol. Its IUPAC name is 2-[4-[[3-carbamoyl-6-[3-[(4-methoxybenzoyl)amino]piperidin-1-yl]pyrazin-2-yl]amino]phenoxy]-N,N-dimethylethanamine oxide.
| Compound Name | 2-[4-[[3-carbamoyl-6-[3-[(4-methoxybenzoyl)amino]piperidin-1-yl]pyrazin-2-yl]amino]phenoxy]-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 118115194 |
| Molecular Formula | C28H35N7O5 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 2-[4-[[3-carbamoyl-6-[3-[(4-methoxybenzoyl)amino]piperidin-1-yl]pyrazin-2-yl]amino]phenoxy]-N,N-dimethylethanamine oxide |
| SMILES | COc1ccc(C(=O)NC2CCCN(c3cnc(C(N)=O)c(Nc4ccc(OCC[N+](C)(C)[O-])cc4)n3)C2)cc1 |
| InChI | InChI=1S/C28H35N7O5/c1-35(2,38)15-16-40-23-12-8-20(9-13-23)31-27-25(26(29)36)30-17-24(33-27)34-14-4-5-21(18-34)32-28(37)19-6-10-22(39-3)11-7-19/h6-13,17,21H,4-5,14-16,18H2,1-3H3,(H2,29,36)(H,31,33)(H,32,37) |
| InChIKey | ZZVZIYUBVGMCQA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|