C28H35N7O4 — CID 118143000
3-[4-(2-methoxyethoxy)anilino]-5-[(3R)-3-(2-phenylethylcarbamoylamino)piperidin-1-yl]pyrazine-2-carboxamide (PubChem CID 118143000) has the molecular formula C28H35N7O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is 3-[4-(2-methoxyethoxy)anilino]-5-[(3R)-3-(2-phenylethylcarbamoylamino)piperidin-1-yl]pyrazine-2-carboxamide.
| Compound Name | 3-[4-(2-methoxyethoxy)anilino]-5-[(3R)-3-(2-phenylethylcarbamoylamino)piperidin-1-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118143000 |
| Molecular Formula | C28H35N7O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 3-[4-(2-methoxyethoxy)anilino]-5-[(3R)-3-(2-phenylethylcarbamoylamino)piperidin-1-yl]pyrazine-2-carboxamide |
| SMILES | COCCOc1ccc(Nc2nc(N3CCC[C@@H](NC(=O)NCCc4ccccc4)C3)cnc2C(N)=O)cc1 |
| InChI | InChI=1S/C28H35N7O4/c1-38-16-17-39-23-11-9-21(10-12-23)32-27-25(26(29)36)31-18-24(34-27)35-15-5-8-22(19-35)33-28(37)30-14-13-20-6-3-2-4-7-20/h2-4,6-7,9-12,18,22H,5,8,13-17,19H2,1H3,(H2,29,36)(H,32,34)(H2,30,33,37)/t22-/m1/s1 |
| InChIKey | AHCZWXLZUPLLAX-JOCHJYFZSA-N |
| XLogP | 2.86 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|