C28H29N7O3 — CID 118143107
5-[3-(4-methoxyanilino)piperidin-1-yl]-3-[4-(2-oxo-1-pyridinyl)anilino]pyrazine-2-carboxamide (PubChem CID 118143107) has the molecular formula C28H29N7O3 and a molecular weight of 511.59 g/mol. Its IUPAC name is 5-[3-(4-methoxyanilino)piperidin-1-yl]-3-[4-(2-oxo-1-pyridinyl)anilino]pyrazine-2-carboxamide.
| Compound Name | 5-[3-(4-methoxyanilino)piperidin-1-yl]-3-[4-(2-oxo-1-pyridinyl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118143107 |
| Molecular Formula | C28H29N7O3 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 5-[3-(4-methoxyanilino)piperidin-1-yl]-3-[4-(2-oxo-1-pyridinyl)anilino]pyrazine-2-carboxamide |
| SMILES | COc1ccc(NC2CCCN(c3cnc(C(N)=O)c(Nc4ccc(-n5ccccc5=O)cc4)n3)C2)cc1 |
| InChI | InChI=1S/C28H29N7O3/c1-38-23-13-9-19(10-14-23)31-21-5-4-15-34(18-21)24-17-30-26(27(29)37)28(33-24)32-20-7-11-22(12-8-20)35-16-3-2-6-25(35)36/h2-3,6-14,16-17,21,31H,4-5,15,18H2,1H3,(H2,29,37)(H,32,33) |
| InChIKey | FVCAKYWNEDENAN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|