C27H32N8O4 — CID 118143269
3-[3-(4-methoxyanilino)piperidin-1-yl]-5-[4-(morpholine-4-carbonyl)anilino]-1,2,4-triazine-6-carboxamide (PubChem CID 118143269) has the molecular formula C27H32N8O4 and a molecular weight of 532.61 g/mol. Its IUPAC name is 3-[3-(4-methoxyanilino)piperidin-1-yl]-5-[4-(morpholine-4-carbonyl)anilino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 3-[3-(4-methoxyanilino)piperidin-1-yl]-5-[4-(morpholine-4-carbonyl)anilino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 118143269 |
| Molecular Formula | C27H32N8O4 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 3-[3-(4-methoxyanilino)piperidin-1-yl]-5-[4-(morpholine-4-carbonyl)anilino]-1,2,4-triazine-6-carboxamide |
| SMILES | COc1ccc(NC2CCCN(c3nnc(C(N)=O)c(Nc4ccc(C(=O)N5CCOCC5)cc4)n3)C2)cc1 |
| InChI | InChI=1S/C27H32N8O4/c1-38-22-10-8-19(9-11-22)29-21-3-2-12-35(17-21)27-31-25(23(24(28)36)32-33-27)30-20-6-4-18(5-7-20)26(37)34-13-15-39-16-14-34/h4-11,21,29H,2-3,12-17H2,1H3,(H2,28,36)(H,30,31,33) |
| InChIKey | GZVUCBOIGOTWEI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 147.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|