C23H33N9O2 — CID 150799064
5-[4-(morpholine-4-carbonyl)anilino]-3-[(3R)-3-(propan-2-ylamino)piperidin-1-yl]-1,2,4-triazine-6-carboximidamide (PubChem CID 150799064) has the molecular formula C23H33N9O2 and a molecular weight of 467.58 g/mol. Its IUPAC name is 5-[4-(morpholine-4-carbonyl)anilino]-3-[(3R)-3-(propan-2-ylamino)piperidin-1-yl]-1,2,4-triazine-6-carboximidamide.
| Compound Name | 5-[4-(morpholine-4-carbonyl)anilino]-3-[(3R)-3-(propan-2-ylamino)piperidin-1-yl]-1,2,4-triazine-6-carboximidamide |
|---|---|
| PubChem CID | 150799064 |
| Molecular Formula | C23H33N9O2 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 5-[4-(morpholine-4-carbonyl)anilino]-3-[(3R)-3-(propan-2-ylamino)piperidin-1-yl]-1,2,4-triazine-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1nnc(N2CCC[C@@H](NC(C)C)C2)nc1Nc1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H33N9O2/c1-15(2)26-18-4-3-9-32(14-18)23-28-21(19(20(24)25)29-30-23)27-17-7-5-16(6-8-17)22(33)31-10-12-34-13-11-31/h5-8,15,18,26H,3-4,9-14H2,1-2H3,(H3,24,25)(H,27,28,30)/t18-/m1/s1 |
| InChIKey | KFLOXWGITUFOOC-GOSISDBHSA-N |
| XLogP | 1.34 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|