C31H41N9O2 — CID 118143169
5-[4-(4-cyclopentylpiperazin-1-yl)anilino]-3-[3-(4-methoxyanilino)piperidin-1-yl]-1,2,4-triazine-6-carboxamide (PubChem CID 118143169) has the molecular formula C31H41N9O2 and a molecular weight of 571.73 g/mol. Its IUPAC name is 5-[4-(4-cyclopentylpiperazin-1-yl)anilino]-3-[3-(4-methoxyanilino)piperidin-1-yl]-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-[4-(4-cyclopentylpiperazin-1-yl)anilino]-3-[3-(4-methoxyanilino)piperidin-1-yl]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 118143169 |
| Molecular Formula | C31H41N9O2 |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | 5-[4-(4-cyclopentylpiperazin-1-yl)anilino]-3-[3-(4-methoxyanilino)piperidin-1-yl]-1,2,4-triazine-6-carboxamide |
| SMILES | COc1ccc(NC2CCCN(c3nnc(C(N)=O)c(Nc4ccc(N5CCN(C6CCCC6)CC5)cc4)n3)C2)cc1 |
| InChI | InChI=1S/C31H41N9O2/c1-42-27-14-10-22(11-15-27)33-24-5-4-16-40(21-24)31-35-30(28(29(32)41)36-37-31)34-23-8-12-26(13-9-23)39-19-17-38(18-20-39)25-6-2-3-7-25/h8-15,24-25,33H,2-7,16-21H2,1H3,(H2,32,41)(H,34,35,37) |
| InChIKey | XZLABHSYCRVZCT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|