C24H27N7O4S — CID 135362018
3-(4-methylsulfonylanilino)-5-[3-(phenylcarbamoylamino)piperidin-1-yl]pyrazine-2-carboxamide (PubChem CID 135362018) has the molecular formula C24H27N7O4S and a molecular weight of 509.59 g/mol. Its IUPAC name is 3-(4-methylsulfonylanilino)-5-[3-(phenylcarbamoylamino)piperidin-1-yl]pyrazine-2-carboxamide.
| Compound Name | 3-(4-methylsulfonylanilino)-5-[3-(phenylcarbamoylamino)piperidin-1-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 135362018 |
| Molecular Formula | C24H27N7O4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 3-(4-methylsulfonylanilino)-5-[3-(phenylcarbamoylamino)piperidin-1-yl]pyrazine-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(Nc2nc(N3CCCC(NC(=O)Nc4ccccc4)C3)cnc2C(N)=O)cc1 |
| InChI | InChI=1S/C24H27N7O4S/c1-36(34,35)19-11-9-17(10-12-19)27-23-21(22(25)32)26-14-20(30-23)31-13-5-8-18(15-31)29-24(33)28-16-6-3-2-4-7-16/h2-4,6-7,9-12,14,18H,5,8,13,15H2,1H3,(H2,25,32)(H,27,30)(H2,28,29,33) |
| InChIKey | GAUAYWWGPUEIKJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |