C20H27N7O4S — CID 174813382
5-[(3R)-3-[2-methyl-2-(2-oxoethyl)hydrazinyl]piperidin-1-yl]-3-(4-methylsulfonylanilino)pyrazine-2-carboxamide (PubChem CID 174813382) has the molecular formula C20H27N7O4S and a molecular weight of 461.55 g/mol. Its IUPAC name is 5-[(3R)-3-[2-methyl-2-(2-oxoethyl)hydrazinyl]piperidin-1-yl]-3-(4-methylsulfonylanilino)pyrazine-2-carboxamide.
| Compound Name | 5-[(3R)-3-[2-methyl-2-(2-oxoethyl)hydrazinyl]piperidin-1-yl]-3-(4-methylsulfonylanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174813382 |
| Molecular Formula | C20H27N7O4S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 5-[(3R)-3-[2-methyl-2-(2-oxoethyl)hydrazinyl]piperidin-1-yl]-3-(4-methylsulfonylanilino)pyrazine-2-carboxamide |
| SMILES | CN(CC=O)N[C@@H]1CCCN(c2cnc(C(N)=O)c(Nc3ccc(S(C)(=O)=O)cc3)n2)C1 |
| InChI | InChI=1S/C20H27N7O4S/c1-26(10-11-28)25-15-4-3-9-27(13-15)17-12-22-18(19(21)29)20(24-17)23-14-5-7-16(8-6-14)32(2,30)31/h5-8,11-12,15,25H,3-4,9-10,13H2,1-2H3,(H2,21,29)(H,23,24)/t15-/m1/s1 |
| InChIKey | JOPKUOASDXOYAV-OAHLLOKOSA-N |
| XLogP | 0.33 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|