C19H26N6O3S — CID 174973938
2-[methyl-[[(3R)-1-[6-(4-methylsulfonylanilino)pyrazin-2-yl]piperidin-3-yl]amino]amino]acetaldehyde (PubChem CID 174973938) has the molecular formula C19H26N6O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-[methyl-[[(3R)-1-[6-(4-methylsulfonylanilino)pyrazin-2-yl]piperidin-3-yl]amino]amino]acetaldehyde.
| Compound Name | 2-[methyl-[[(3R)-1-[6-(4-methylsulfonylanilino)pyrazin-2-yl]piperidin-3-yl]amino]amino]acetaldehyde |
|---|---|
| PubChem CID | 174973938 |
| Molecular Formula | C19H26N6O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-[methyl-[[(3R)-1-[6-(4-methylsulfonylanilino)pyrazin-2-yl]piperidin-3-yl]amino]amino]acetaldehyde |
| SMILES | CN(CC=O)N[C@@H]1CCCN(c2cncc(Nc3ccc(S(C)(=O)=O)cc3)n2)C1 |
| InChI | InChI=1S/C19H26N6O3S/c1-24(10-11-26)23-16-4-3-9-25(14-16)19-13-20-12-18(22-19)21-15-5-7-17(8-6-15)29(2,27)28/h5-8,11-13,16,23H,3-4,9-10,14H2,1-2H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | YYNJGKLBAWGQFC-MRXNPFEDSA-N |
| XLogP | 1.23 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|