C11H19N5 — CID 80831870
6-[3-(dimethylamino)pyrrolidin-1-yl]-N-methylpyrazin-2-amine (PubChem CID 80831870) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 6-[3-(dimethylamino)pyrrolidin-1-yl]-N-methylpyrazin-2-amine.
| Compound Name | 6-[3-(dimethylamino)pyrrolidin-1-yl]-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 80831870 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 6-[3-(dimethylamino)pyrrolidin-1-yl]-N-methylpyrazin-2-amine |
| SMILES | CNc1cncc(N2CCC(N(C)C)C2)n1 |
| InChI | InChI=1S/C11H19N5/c1-12-10-6-13-7-11(14-10)16-5-4-9(8-16)15(2)3/h6-7,9H,4-5,8H2,1-3H3,(H,12,14) |
| InChIKey | MJBRPXSBECUAHW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |