C10H13N5O — CID 80849516
4-[6-(methylamino)pyrazin-2-yl]morpholine-2-carbonitrile (PubChem CID 80849516) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 4-[6-(methylamino)pyrazin-2-yl]morpholine-2-carbonitrile.
| Compound Name | 4-[6-(methylamino)pyrazin-2-yl]morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 80849516 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4-[6-(methylamino)pyrazin-2-yl]morpholine-2-carbonitrile |
| SMILES | CNc1cncc(N2CCOC(C#N)C2)n1 |
| InChI | InChI=1S/C10H13N5O/c1-12-9-5-13-6-10(14-9)15-2-3-16-8(4-11)7-15/h5-6,8H,2-3,7H2,1H3,(H,12,14) |
| InChIKey | WBVADVPEIWDDQJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |