C9H12N6O — CID 80929416
4-(2-hydrazinylpyrimidin-4-yl)morpholine-2-carbonitrile (PubChem CID 80929416) has the molecular formula C9H12N6O and a molecular weight of 220.24 g/mol. Its IUPAC name is 4-(2-hydrazinylpyrimidin-4-yl)morpholine-2-carbonitrile.
| Compound Name | 4-(2-hydrazinylpyrimidin-4-yl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 80929416 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4-(2-hydrazinylpyrimidin-4-yl)morpholine-2-carbonitrile |
| SMILES | N#CC1CN(c2ccnc(NN)n2)CCO1 |
| InChI | InChI=1S/C9H12N6O/c10-5-7-6-15(3-4-16-7)8-1-2-12-9(13-8)14-11/h1-2,7H,3-4,6,11H2,(H,12,13,14) |
| InChIKey | YOIATALSALFLTB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|