About [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine
[4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine (PubChem CID 80918713) has the molecular formula C10H17N5O
and a molecular weight of 223.28 g/mol. Its IUPAC name is [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine |
| PubChem CID | 80918713 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine |
| SMILES | CC1CN(c2ccnc(NN)n2)CCCO1 |
| InChI | InChI=1S/C10H17N5O/c1-8-7-15(5-2-6-16-8)9-3-4-12-10(13-9)14-11/h3-4,8H,2,5-7,11H2,1H3,(H,12,13,14) |
| InChIKey | FFFMXSPKFZQYHS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine?
The IUPAC name of [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine (CID 80918713) is [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine.
What is the SMILES notation for [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine?
The canonical SMILES for [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine is CC1CN(c2ccnc(NN)n2)CCCO1.
What is the InChIKey of [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine?
The InChIKey is FFFMXSPKFZQYHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O/c1-8-7-15(5-2-6-16-8)9-3-4-12-10(13-9)14-11/h3-4,8H,2,5-7,11H2,1H3,(H,12,13,14).
What are the key properties of [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine?
[4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine has a molecular weight of 223.28 g/mol, XLogP of 0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methyl-1,4-oxazepan-4-yl)pyrimidin-2-yl]hydrazine is sourced from PubChem (CID 80918713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).