C27H33N5O4 — CID 174974658
N-[(3R)-1-[6-[4-(2-ethoxyethoxy)anilino]pyrazin-2-yl]piperidin-3-yl]-4-methoxybenzamide (PubChem CID 174974658) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[(3R)-1-[6-[4-(2-ethoxyethoxy)anilino]pyrazin-2-yl]piperidin-3-yl]-4-methoxybenzamide.
| Compound Name | N-[(3R)-1-[6-[4-(2-ethoxyethoxy)anilino]pyrazin-2-yl]piperidin-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 174974658 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-[(3R)-1-[6-[4-(2-ethoxyethoxy)anilino]pyrazin-2-yl]piperidin-3-yl]-4-methoxybenzamide |
| SMILES | CCOCCOc1ccc(Nc2cncc(N3CCC[C@@H](NC(=O)c4ccc(OC)cc4)C3)n2)cc1 |
| InChI | InChI=1S/C27H33N5O4/c1-3-35-15-16-36-24-12-8-21(9-13-24)29-25-17-28-18-26(31-25)32-14-4-5-22(19-32)30-27(33)20-6-10-23(34-2)11-7-20/h6-13,17-18,22H,3-5,14-16,19H2,1-2H3,(H,29,31)(H,30,33)/t22-/m1/s1 |
| InChIKey | VZWCSTFNJWVNKO-JOCHJYFZSA-N |
| XLogP | 4.04 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|