C28H34FN5O3 — CID 135370188
4-tert-butyl-N-[1-[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]pyrrolidin-3-yl]benzamide (PubChem CID 135370188) has the molecular formula C28H34FN5O3 and a molecular weight of 507.61 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]pyrrolidin-3-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 135370188 |
| Molecular Formula | C28H34FN5O3 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 4-tert-butyl-N-[1-[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]pyrrolidin-3-yl]benzamide |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(N3CCC(NC(=O)c4ccc(C(C)(C)C)cc4)C3)n2)cc1 |
| InChI | InChI=1S/C28H34FN5O3/c1-28(2,3)20-7-5-19(6-8-20)26(35)31-22-13-14-34(18-22)25-24(29)17-30-27(33-25)32-21-9-11-23(12-10-21)37-16-15-36-4/h5-12,17,22H,13-16,18H2,1-4H3,(H,31,35)(H,30,32,33) |
| InChIKey | VXXRXVRARNQORU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|