C31H35F2N7O2 — CID 145201377
5-[(3R)-3-[(4-cyclopropylbenzoyl)amino]piperidin-1-yl]-3-[4-(4,4-difluoropiperidin-1-yl)anilino]pyrazine-2-carboxamide (PubChem CID 145201377) has the molecular formula C31H35F2N7O2 and a molecular weight of 575.66 g/mol. Its IUPAC name is 5-[(3R)-3-[(4-cyclopropylbenzoyl)amino]piperidin-1-yl]-3-[4-(4,4-difluoropiperidin-1-yl)anilino]pyrazine-2-carboxamide.
| Compound Name | 5-[(3R)-3-[(4-cyclopropylbenzoyl)amino]piperidin-1-yl]-3-[4-(4,4-difluoropiperidin-1-yl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 145201377 |
| Molecular Formula | C31H35F2N7O2 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 5-[(3R)-3-[(4-cyclopropylbenzoyl)amino]piperidin-1-yl]-3-[4-(4,4-difluoropiperidin-1-yl)anilino]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1ncc(N2CCC[C@@H](NC(=O)c3ccc(C4CC4)cc3)C2)nc1Nc1ccc(N2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C31H35F2N7O2/c32-31(33)13-16-39(17-14-31)25-11-9-23(10-12-25)36-29-27(28(34)41)35-18-26(38-29)40-15-1-2-24(19-40)37-30(42)22-7-5-21(6-8-22)20-3-4-20/h5-12,18,20,24H,1-4,13-17,19H2,(H2,34,41)(H,36,38)(H,37,42)/t24-/m1/s1 |
| InChIKey | VHEWCSWIMYLXCF-XMMPIXPASA-N |
| XLogP | 4.83 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|