C20H24N8O2 — CID 66783466
2-[4-(4-acetylpiperazin-1-yl)anilino]-4-(2-cyanoethylamino)pyrimidine-5-carboxamide (PubChem CID 66783466) has the molecular formula C20H24N8O2 and a molecular weight of 408.47 g/mol. Its IUPAC name is 2-[4-(4-acetylpiperazin-1-yl)anilino]-4-(2-cyanoethylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-[4-(4-acetylpiperazin-1-yl)anilino]-4-(2-cyanoethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66783466 |
| Molecular Formula | C20H24N8O2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[4-(4-acetylpiperazin-1-yl)anilino]-4-(2-cyanoethylamino)pyrimidine-5-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3ncc(C(N)=O)c(NCCC#N)n3)cc2)CC1 |
| InChI | InChI=1S/C20H24N8O2/c1-14(29)27-9-11-28(12-10-27)16-5-3-15(4-6-16)25-20-24-13-17(18(22)30)19(26-20)23-8-2-7-21/h3-6,13H,2,8-12H2,1H3,(H2,22,30)(H2,23,24,25,26) |
| InChIKey | FUDXGTLHDAKFNO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|