C20H29N9O2 — CID 143890381
amino-[2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-4-methoxyanilino]pyrimidin-5-yl]methanol (PubChem CID 143890381) has the molecular formula C20H29N9O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is amino-[2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-4-methoxyanilino]pyrimidin-5-yl]methanol.
| Compound Name | amino-[2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-4-methoxyanilino]pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 143890381 |
| Molecular Formula | C20H29N9O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | amino-[2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-4-methoxyanilino]pyrimidin-5-yl]methanol |
| SMILES | [H]/N=C\C=N/Nc1cc(Nc2nc(N[C@@H]3CCCC[C@@H]3N)ncc2C(N)O)ccc1OC |
| InChI | InChI=1S/C20H29N9O2/c1-31-17-7-6-12(10-16(17)29-25-9-8-21)26-19-13(18(23)30)11-24-20(28-19)27-15-5-3-2-4-14(15)22/h6-11,14-15,18,21,29-30H,2-5,22-23H2,1H3,(H2,24,26,27,28)/b21-8-,25-9-/t14-,15+,18?/m0/s1 |
| InChIKey | LGIBMVRHQLCQME-VSSPSOCPSA-N |
| XLogP | 1.91 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|