C15H20N8O — CID 18460850
2-[2-(diaminomethylideneamino)ethylamino]-4-(3-methylanilino)pyrimidine-5-carboxamide (PubChem CID 18460850) has the molecular formula C15H20N8O and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-[2-(diaminomethylideneamino)ethylamino]-4-(3-methylanilino)pyrimidine-5-carboxamide.
| Compound Name | 2-[2-(diaminomethylideneamino)ethylamino]-4-(3-methylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 18460850 |
| Molecular Formula | C15H20N8O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-[2-(diaminomethylideneamino)ethylamino]-4-(3-methylanilino)pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(Nc2nc(NCCN=C(N)N)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C15H20N8O/c1-9-3-2-4-10(7-9)22-13-11(12(16)24)8-21-15(23-13)20-6-5-19-14(17)18/h2-4,7-8H,5-6H2,1H3,(H2,16,24)(H4,17,18,19)(H2,20,21,22,23) |
| InChIKey | HAQLEXVPBJORKC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|