C19H19N5O2 — CID 44540634
2-[3-(hydroxymethyl)anilino]-4-(3-methylanilino)pyrimidine-5-carboxamide (PubChem CID 44540634) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)anilino]-4-(3-methylanilino)pyrimidine-5-carboxamide.
| Compound Name | 2-[3-(hydroxymethyl)anilino]-4-(3-methylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 44540634 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-[3-(hydroxymethyl)anilino]-4-(3-methylanilino)pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(Nc2nc(Nc3cccc(CO)c3)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C19H19N5O2/c1-12-4-2-6-14(8-12)22-18-16(17(20)26)10-21-19(24-18)23-15-7-3-5-13(9-15)11-25/h2-10,25H,11H2,1H3,(H2,20,26)(H2,21,22,23,24) |
| InChIKey | DHTTWMLNYQOYTF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |