C15H15N7O2 — CID 70657979
2-[4-(hydroxymethyl)triazol-1-yl]-4-(3-methylanilino)pyrimidine-5-carboxamide (PubChem CID 70657979) has the molecular formula C15H15N7O2 and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)triazol-1-yl]-4-(3-methylanilino)pyrimidine-5-carboxamide.
| Compound Name | 2-[4-(hydroxymethyl)triazol-1-yl]-4-(3-methylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70657979 |
| Molecular Formula | C15H15N7O2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[4-(hydroxymethyl)triazol-1-yl]-4-(3-methylanilino)pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(Nc2nc(-n3cc(CO)nn3)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C15H15N7O2/c1-9-3-2-4-10(5-9)18-14-12(13(16)24)6-17-15(19-14)22-7-11(8-23)20-21-22/h2-7,23H,8H2,1H3,(H2,16,24)(H,17,18,19) |
| InChIKey | PXUKHYQXSGKICJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |