C21H21Cl2N5O2 — CID 91126087
2-[[2-(3,5-dichloro-4-hydroxyphenyl)ethylamino]methyl]-4-(3-methylanilino)pyrimidine-5-carboxamide (PubChem CID 91126087) has the molecular formula C21H21Cl2N5O2 and a molecular weight of 446.34 g/mol. Its IUPAC name is 2-[[2-(3,5-dichloro-4-hydroxyphenyl)ethylamino]methyl]-4-(3-methylanilino)pyrimidine-5-carboxamide.
| Compound Name | 2-[[2-(3,5-dichloro-4-hydroxyphenyl)ethylamino]methyl]-4-(3-methylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91126087 |
| Molecular Formula | C21H21Cl2N5O2 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 2-[[2-(3,5-dichloro-4-hydroxyphenyl)ethylamino]methyl]-4-(3-methylanilino)pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(Nc2nc(CNCCc3cc(Cl)c(O)c(Cl)c3)ncc2C(N)=O)c1 |
| InChI | InChI=1S/C21H21Cl2N5O2/c1-12-3-2-4-14(7-12)27-21-15(20(24)30)10-26-18(28-21)11-25-6-5-13-8-16(22)19(29)17(23)9-13/h2-4,7-10,25,29H,5-6,11H2,1H3,(H2,24,30)(H,26,27,28) |
| InChIKey | SJDNJZSOGUQFFE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|