C19H19N7O2 — CID 58098627
4-(benzylamino)-2-[3-(carbamoylamino)anilino]pyrimidine-5-carboxamide (PubChem CID 58098627) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 4-(benzylamino)-2-[3-(carbamoylamino)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(benzylamino)-2-[3-(carbamoylamino)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 58098627 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4-(benzylamino)-2-[3-(carbamoylamino)anilino]pyrimidine-5-carboxamide |
| SMILES | NC(=O)Nc1cccc(Nc2ncc(C(N)=O)c(NCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H19N7O2/c20-16(27)15-11-23-19(25-14-8-4-7-13(9-14)24-18(21)28)26-17(15)22-10-12-5-2-1-3-6-12/h1-9,11H,10H2,(H2,20,27)(H3,21,24,28)(H2,22,23,25,26) |
| InChIKey | POOZEIYYVDSMKC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |