C23H26N6O3 — CID 91053236
2-[3-(2-methoxypropanoylamino)anilino]-4-(2-phenylethylamino)pyrimidine-5-carboxamide (PubChem CID 91053236) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[3-(2-methoxypropanoylamino)anilino]-4-(2-phenylethylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-[3-(2-methoxypropanoylamino)anilino]-4-(2-phenylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91053236 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[3-(2-methoxypropanoylamino)anilino]-4-(2-phenylethylamino)pyrimidine-5-carboxamide |
| SMILES | COC(C)C(=O)Nc1cccc(Nc2ncc(C(N)=O)c(NCCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H26N6O3/c1-15(32-2)22(31)27-17-9-6-10-18(13-17)28-23-26-14-19(20(24)30)21(29-23)25-12-11-16-7-4-3-5-8-16/h3-10,13-15H,11-12H2,1-2H3,(H2,24,30)(H,27,31)(H2,25,26,28,29) |
| InChIKey | QOWCZDXVSNPGRI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |