C23H22N6O2 — CID 69284689
2-(3-acetamidoanilino)-5-cyano-6-(2-phenylethylamino)pyridine-3-carboxamide (PubChem CID 69284689) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-(3-acetamidoanilino)-5-cyano-6-(2-phenylethylamino)pyridine-3-carboxamide.
| Compound Name | 2-(3-acetamidoanilino)-5-cyano-6-(2-phenylethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69284689 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-(3-acetamidoanilino)-5-cyano-6-(2-phenylethylamino)pyridine-3-carboxamide |
| SMILES | CC(=O)Nc1cccc(Nc2nc(NCCc3ccccc3)c(C#N)cc2C(N)=O)c1 |
| InChI | InChI=1S/C23H22N6O2/c1-15(30)27-18-8-5-9-19(13-18)28-23-20(21(25)31)12-17(14-24)22(29-23)26-11-10-16-6-3-2-4-7-16/h2-9,12-13H,10-11H2,1H3,(H2,25,31)(H,27,30)(H2,26,28,29) |
| InChIKey | MGIFSWCFSNHTDH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |