C23H23N7O2 — CID 66841654
4-(benzylamino)-2-[3-(2,5-dihydropyrrole-1-carbonylamino)anilino]pyrimidine-5-carboxamide (PubChem CID 66841654) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-(benzylamino)-2-[3-(2,5-dihydropyrrole-1-carbonylamino)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(benzylamino)-2-[3-(2,5-dihydropyrrole-1-carbonylamino)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66841654 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 4-(benzylamino)-2-[3-(2,5-dihydropyrrole-1-carbonylamino)anilino]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2cccc(NC(=O)N3CC=CC3)c2)nc1NCc1ccccc1 |
| InChI | InChI=1S/C23H23N7O2/c24-20(31)19-15-26-22(29-21(19)25-14-16-7-2-1-3-8-16)27-17-9-6-10-18(13-17)28-23(32)30-11-4-5-12-30/h1-10,13,15H,11-12,14H2,(H2,24,31)(H,28,32)(H2,25,26,27,29) |
| InChIKey | IHMDKDGPQJOYAB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|